C19H20FNO3S — CID 70754050
[2-(4-fluorophenyl)piperidin-1-yl]-(4-methylsulfonylphenyl)methanone (PubChem CID 70754050) has the molecular formula C19H20FNO3S and a molecular weight of 361.44 g/mol. Its IUPAC name is [2-(4-fluorophenyl)piperidin-1-yl]-(4-methylsulfonylphenyl)methanone.
| Compound Name | [2-(4-fluorophenyl)piperidin-1-yl]-(4-methylsulfonylphenyl)methanone |
|---|---|
| PubChem CID | 70754050 |
| Molecular Formula | C19H20FNO3S |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | [2-(4-fluorophenyl)piperidin-1-yl]-(4-methylsulfonylphenyl)methanone |
| SMILES | CS(=O)(=O)c1ccc(C(=O)N2CCCCC2c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C19H20FNO3S/c1-25(23,24)17-11-7-15(8-12-17)19(22)21-13-3-2-4-18(21)14-5-9-16(20)10-6-14/h5-12,18H,2-4,13H2,1H3 |
| InChIKey | YACQCKZMILGGJH-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |