C21H17N3O5S2 — CID 167928414
2-hydroxy-N-(1-methyl-2-oxoquinolin-7-yl)-4-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 167928414) has the molecular formula C21H17N3O5S2 and a molecular weight of 455.52 g/mol. Its IUPAC name is 2-hydroxy-N-(1-methyl-2-oxoquinolin-7-yl)-4-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | 2-hydroxy-N-(1-methyl-2-oxoquinolin-7-yl)-4-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 167928414 |
| Molecular Formula | C21H17N3O5S2 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.06 |
| IUPAC Name | 2-hydroxy-N-(1-methyl-2-oxoquinolin-7-yl)-4-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | Cn1c(=O)ccc2ccc(NC(=O)c3ccc(NS(=O)(=O)c4cccs4)cc3O)cc21 |
| InChI | InChI=1S/C21H17N3O5S2/c1-24-17-11-14(6-4-13(17)5-9-19(24)26)22-21(27)16-8-7-15(12-18(16)25)23-31(28,29)20-3-2-10-30-20/h2-12,23,25H,1H3,(H,22,27) |
| InChIKey | QUVYWVHAMKYKLH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 117.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |