C17H16N2O5S2 — CID 86980610
N-[1-(furan-2-yl)ethyl]-2-hydroxy-4-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 86980610) has the molecular formula C17H16N2O5S2 and a molecular weight of 392.46 g/mol. Its IUPAC name is N-[1-(furan-2-yl)ethyl]-2-hydroxy-4-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-[1-(furan-2-yl)ethyl]-2-hydroxy-4-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 86980610 |
| Molecular Formula | C17H16N2O5S2 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.05 |
| IUPAC Name | N-[1-(furan-2-yl)ethyl]-2-hydroxy-4-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | CC(NC(=O)c1ccc(NS(=O)(=O)c2cccs2)cc1O)c1ccco1 |
| InChI | InChI=1S/C17H16N2O5S2/c1-11(15-4-2-8-24-15)18-17(21)13-7-6-12(10-14(13)20)19-26(22,23)16-5-3-9-25-16/h2-11,19-20H,1H3,(H,18,21) |
| InChIKey | GHJLVFURRAJUTP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |