C19H18N2O4S2 — CID 78847492
N-benzyl-2-hydroxy-N-methyl-4-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 78847492) has the molecular formula C19H18N2O4S2 and a molecular weight of 402.50 g/mol. Its IUPAC name is N-benzyl-2-hydroxy-N-methyl-4-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-benzyl-2-hydroxy-N-methyl-4-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 78847492 |
| Molecular Formula | C19H18N2O4S2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | N-benzyl-2-hydroxy-N-methyl-4-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | CN(Cc1ccccc1)C(=O)c1ccc(NS(=O)(=O)c2cccs2)cc1O |
| InChI | InChI=1S/C19H18N2O4S2/c1-21(13-14-6-3-2-4-7-14)19(23)16-10-9-15(12-17(16)22)20-27(24,25)18-8-5-11-26-18/h2-12,20,22H,13H2,1H3 |
| InChIKey | ZTCXUUQCAAZKPE-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |