C20H17F3N2O3S2 — CID 55787151
N-methyl-3-(thiophen-2-ylsulfonylamino)-N-[[4-(trifluoromethyl)phenyl]methyl]benzamide (PubChem CID 55787151) has the molecular formula C20H17F3N2O3S2 and a molecular weight of 454.50 g/mol. Its IUPAC name is N-methyl-3-(thiophen-2-ylsulfonylamino)-N-[[4-(trifluoromethyl)phenyl]methyl]benzamide.
| Compound Name | N-methyl-3-(thiophen-2-ylsulfonylamino)-N-[[4-(trifluoromethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 55787151 |
| Molecular Formula | C20H17F3N2O3S2 |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.06 |
| IUPAC Name | N-methyl-3-(thiophen-2-ylsulfonylamino)-N-[[4-(trifluoromethyl)phenyl]methyl]benzamide |
| SMILES | CN(Cc1ccc(C(F)(F)F)cc1)C(=O)c1cccc(NS(=O)(=O)c2cccs2)c1 |
| InChI | InChI=1S/C20H17F3N2O3S2/c1-25(13-14-7-9-16(10-8-14)20(21,22)23)19(26)15-4-2-5-17(12-15)24-30(27,28)18-6-3-11-29-18/h2-12,24H,13H2,1H3 |
| InChIKey | VZXGADIITVOGBQ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |