C25H19NO6S2 — CID 25042549
[2-oxo-2-(4-phenylphenyl)ethyl] 2-hydroxy-4-(thiophen-2-ylsulfonylamino)benzoate (PubChem CID 25042549) has the molecular formula C25H19NO6S2 and a molecular weight of 493.56 g/mol. Its IUPAC name is [2-oxo-2-(4-phenylphenyl)ethyl] 2-hydroxy-4-(thiophen-2-ylsulfonylamino)benzoate.
| Compound Name | [2-oxo-2-(4-phenylphenyl)ethyl] 2-hydroxy-4-(thiophen-2-ylsulfonylamino)benzoate |
|---|---|
| PubChem CID | 25042549 |
| Molecular Formula | C25H19NO6S2 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.07 |
| IUPAC Name | [2-oxo-2-(4-phenylphenyl)ethyl] 2-hydroxy-4-(thiophen-2-ylsulfonylamino)benzoate |
| SMILES | O=C(COC(=O)c1ccc(NS(=O)(=O)c2cccs2)cc1O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H19NO6S2/c27-22-15-20(26-34(30,31)24-7-4-14-33-24)12-13-21(22)25(29)32-16-23(28)19-10-8-18(9-11-19)17-5-2-1-3-6-17/h1-15,26-27H,16H2 |
| InChIKey | SMQUNVAASACEMY-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |