C19H14F2N2O6S2 — CID 25041255
[2-(3,4-difluoroanilino)-2-oxoethyl] 2-hydroxy-5-(thiophen-2-ylsulfonylamino)benzoate (PubChem CID 25041255) has the molecular formula C19H14F2N2O6S2 and a molecular weight of 468.46 g/mol. Its IUPAC name is [2-(3,4-difluoroanilino)-2-oxoethyl] 2-hydroxy-5-(thiophen-2-ylsulfonylamino)benzoate.
| Compound Name | [2-(3,4-difluoroanilino)-2-oxoethyl] 2-hydroxy-5-(thiophen-2-ylsulfonylamino)benzoate |
|---|---|
| PubChem CID | 25041255 |
| Molecular Formula | C19H14F2N2O6S2 |
| Molecular Weight | 468.46 g/mol |
| Exact Mass | 468.03 |
| IUPAC Name | [2-(3,4-difluoroanilino)-2-oxoethyl] 2-hydroxy-5-(thiophen-2-ylsulfonylamino)benzoate |
| SMILES | O=C(COC(=O)c1cc(NS(=O)(=O)c2cccs2)ccc1O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H14F2N2O6S2/c20-14-5-3-11(9-15(14)21)22-17(25)10-29-19(26)13-8-12(4-6-16(13)24)23-31(27,28)18-2-1-7-30-18/h1-9,23-24H,10H2,(H,22,25) |
| InChIKey | XCFPFONSVQYARC-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.46 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|