C16H13F2NO5 — CID 18075540
[2-(3,4-difluoroanilino)-2-oxoethyl] 2-hydroxy-3-methoxybenzoate (PubChem CID 18075540) has the molecular formula C16H13F2NO5 and a molecular weight of 337.28 g/mol. Its IUPAC name is [2-(3,4-difluoroanilino)-2-oxoethyl] 2-hydroxy-3-methoxybenzoate.
| Compound Name | [2-(3,4-difluoroanilino)-2-oxoethyl] 2-hydroxy-3-methoxybenzoate |
|---|---|
| PubChem CID | 18075540 |
| Molecular Formula | C16H13F2NO5 |
| Molecular Weight | 337.28 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | [2-(3,4-difluoroanilino)-2-oxoethyl] 2-hydroxy-3-methoxybenzoate |
| SMILES | COc1cccc(C(=O)OCC(=O)Nc2ccc(F)c(F)c2)c1O |
| InChI | InChI=1S/C16H13F2NO5/c1-23-13-4-2-3-10(15(13)21)16(22)24-8-14(20)19-9-5-6-11(17)12(18)7-9/h2-7,21H,8H2,1H3,(H,19,20) |
| InChIKey | ISVPOJKFTHYLQY-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.28 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |