C19H26N2O4S2 — CID 46292162
2-[bis(2-methylpropyl)amino]-5-(thiophen-2-ylsulfonylamino)benzoic acid (PubChem CID 46292162) has the molecular formula C19H26N2O4S2 and a molecular weight of 410.56 g/mol. Its IUPAC name is 2-[bis(2-methylpropyl)amino]-5-(thiophen-2-ylsulfonylamino)benzoic acid.
| Compound Name | 2-[bis(2-methylpropyl)amino]-5-(thiophen-2-ylsulfonylamino)benzoic acid |
|---|---|
| PubChem CID | 46292162 |
| Molecular Formula | C19H26N2O4S2 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 2-[bis(2-methylpropyl)amino]-5-(thiophen-2-ylsulfonylamino)benzoic acid |
| SMILES | CC(C)CN(CC(C)C)c1ccc(NS(=O)(=O)c2cccs2)cc1C(=O)O |
| InChI | InChI=1S/C19H26N2O4S2/c1-13(2)11-21(12-14(3)4)17-8-7-15(10-16(17)19(22)23)20-27(24,25)18-6-5-9-26-18/h5-10,13-14,20H,11-12H2,1-4H3,(H,22,23) |
| InChIKey | LGRCKLCMAYSTSH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|