C23H23N3O5S2 — CID 46291585
2-[4-(4-acetylphenyl)piperazin-1-yl]-5-(thiophen-2-ylsulfonylamino)benzoic acid (PubChem CID 46291585) has the molecular formula C23H23N3O5S2 and a molecular weight of 485.59 g/mol. Its IUPAC name is 2-[4-(4-acetylphenyl)piperazin-1-yl]-5-(thiophen-2-ylsulfonylamino)benzoic acid.
| Compound Name | 2-[4-(4-acetylphenyl)piperazin-1-yl]-5-(thiophen-2-ylsulfonylamino)benzoic acid |
|---|---|
| PubChem CID | 46291585 |
| Molecular Formula | C23H23N3O5S2 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | 2-[4-(4-acetylphenyl)piperazin-1-yl]-5-(thiophen-2-ylsulfonylamino)benzoic acid |
| SMILES | CC(=O)c1ccc(N2CCN(c3ccc(NS(=O)(=O)c4cccs4)cc3C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C23H23N3O5S2/c1-16(27)17-4-7-19(8-5-17)25-10-12-26(13-11-25)21-9-6-18(15-20(21)23(28)29)24-33(30,31)22-3-2-14-32-22/h2-9,14-15,24H,10-13H2,1H3,(H,28,29) |
| InChIKey | KSTOEBNKNJYJQJ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|