C19H22N2O6S2 — CID 92866678
2-[(3R)-3-ethoxycarbonylpiperidin-1-yl]-5-(thiophen-2-ylsulfonylamino)benzoic acid (PubChem CID 92866678) has the molecular formula C19H22N2O6S2 and a molecular weight of 438.53 g/mol. Its IUPAC name is 2-[(3R)-3-ethoxycarbonylpiperidin-1-yl]-5-(thiophen-2-ylsulfonylamino)benzoic acid.
| Compound Name | 2-[(3R)-3-ethoxycarbonylpiperidin-1-yl]-5-(thiophen-2-ylsulfonylamino)benzoic acid |
|---|---|
| PubChem CID | 92866678 |
| Molecular Formula | C19H22N2O6S2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | 2-[(3R)-3-ethoxycarbonylpiperidin-1-yl]-5-(thiophen-2-ylsulfonylamino)benzoic acid |
| SMILES | CCOC(=O)[C@@H]1CCCN(c2ccc(NS(=O)(=O)c3cccs3)cc2C(=O)O)C1 |
| InChI | InChI=1S/C19H22N2O6S2/c1-2-27-19(24)13-5-3-9-21(12-13)16-8-7-14(11-15(16)18(22)23)20-29(25,26)17-6-4-10-28-17/h4,6-8,10-11,13,20H,2-3,5,9,12H2,1H3,(H,22,23)/t13-/m1/s1 |
| InChIKey | WGEYBYDQKNBFIW-CYBMUJFWSA-N |
| XLogP | 3.03 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|