C23H28N2O6S — CID 92887912
5-[(2,4-dimethylphenyl)sulfonylamino]-2-[(3R)-3-ethoxycarbonylpiperidin-1-yl]benzoic acid (PubChem CID 92887912) has the molecular formula C23H28N2O6S and a molecular weight of 460.55 g/mol. Its IUPAC name is 5-[(2,4-dimethylphenyl)sulfonylamino]-2-[(3R)-3-ethoxycarbonylpiperidin-1-yl]benzoic acid.
| Compound Name | 5-[(2,4-dimethylphenyl)sulfonylamino]-2-[(3R)-3-ethoxycarbonylpiperidin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 92887912 |
| Molecular Formula | C23H28N2O6S |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | 5-[(2,4-dimethylphenyl)sulfonylamino]-2-[(3R)-3-ethoxycarbonylpiperidin-1-yl]benzoic acid |
| SMILES | CCOC(=O)[C@@H]1CCCN(c2ccc(NS(=O)(=O)c3ccc(C)cc3C)cc2C(=O)O)C1 |
| InChI | InChI=1S/C23H28N2O6S/c1-4-31-23(28)17-6-5-11-25(14-17)20-9-8-18(13-19(20)22(26)27)24-32(29,30)21-10-7-15(2)12-16(21)3/h7-10,12-13,17,24H,4-6,11,14H2,1-3H3,(H,26,27)/t17-/m1/s1 |
| InChIKey | YYAIRIXJTMUXAV-QGZVFWFLSA-N |
| XLogP | 3.58 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|