C22H25ClN2O7S — CID 92887916
5-[(5-chloro-2-methoxyphenyl)sulfonylamino]-2-[(3R)-3-ethoxycarbonylpiperidin-1-yl]benzoic acid (PubChem CID 92887916) has the molecular formula C22H25ClN2O7S and a molecular weight of 496.97 g/mol. Its IUPAC name is 5-[(5-chloro-2-methoxyphenyl)sulfonylamino]-2-[(3R)-3-ethoxycarbonylpiperidin-1-yl]benzoic acid.
| Compound Name | 5-[(5-chloro-2-methoxyphenyl)sulfonylamino]-2-[(3R)-3-ethoxycarbonylpiperidin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 92887916 |
| Molecular Formula | C22H25ClN2O7S |
| Molecular Weight | 496.97 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | 5-[(5-chloro-2-methoxyphenyl)sulfonylamino]-2-[(3R)-3-ethoxycarbonylpiperidin-1-yl]benzoic acid |
| SMILES | CCOC(=O)[C@@H]1CCCN(c2ccc(NS(=O)(=O)c3cc(Cl)ccc3OC)cc2C(=O)O)C1 |
| InChI | InChI=1S/C22H25ClN2O7S/c1-3-32-22(28)14-5-4-10-25(13-14)18-8-7-16(12-17(18)21(26)27)24-33(29,30)20-11-15(23)6-9-19(20)31-2/h6-9,11-12,14,24H,3-5,10,13H2,1-2H3,(H,26,27)/t14-/m1/s1 |
| InChIKey | OFQBCGXSUSHAQO-CQSZACIVSA-N |
| XLogP | 3.63 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.97 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|