C21H26N2O6S — CID 50766586
5-[(2,5-dimethoxyphenyl)sulfonylamino]-2-(4-methylpiperidin-1-yl)benzoic acid (PubChem CID 50766586) has the molecular formula C21H26N2O6S and a molecular weight of 434.51 g/mol. Its IUPAC name is 5-[(2,5-dimethoxyphenyl)sulfonylamino]-2-(4-methylpiperidin-1-yl)benzoic acid.
| Compound Name | 5-[(2,5-dimethoxyphenyl)sulfonylamino]-2-(4-methylpiperidin-1-yl)benzoic acid |
|---|---|
| PubChem CID | 50766586 |
| Molecular Formula | C21H26N2O6S |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 5-[(2,5-dimethoxyphenyl)sulfonylamino]-2-(4-methylpiperidin-1-yl)benzoic acid |
| SMILES | COc1ccc(OC)c(S(=O)(=O)Nc2ccc(N3CCC(C)CC3)c(C(=O)O)c2)c1 |
| InChI | InChI=1S/C21H26N2O6S/c1-14-8-10-23(11-9-14)18-6-4-15(12-17(18)21(24)25)22-30(26,27)20-13-16(28-2)5-7-19(20)29-3/h4-7,12-14,22H,8-11H2,1-3H3,(H,24,25) |
| InChIKey | RIBHAIRFAOGDHM-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|