C19H24N2O5S — CID 90595596
2,5-dimethoxy-N-[4-(3-methoxypyrrolidin-1-yl)phenyl]benzenesulfonamide (PubChem CID 90595596) has the molecular formula C19H24N2O5S and a molecular weight of 392.48 g/mol. Its IUPAC name is 2,5-dimethoxy-N-[4-(3-methoxypyrrolidin-1-yl)phenyl]benzenesulfonamide.
| Compound Name | 2,5-dimethoxy-N-[4-(3-methoxypyrrolidin-1-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 90595596 |
| Molecular Formula | C19H24N2O5S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 2,5-dimethoxy-N-[4-(3-methoxypyrrolidin-1-yl)phenyl]benzenesulfonamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)Nc2ccc(N3CCC(OC)C3)cc2)c1 |
| InChI | InChI=1S/C19H24N2O5S/c1-24-16-8-9-18(26-3)19(12-16)27(22,23)20-14-4-6-15(7-5-14)21-11-10-17(13-21)25-2/h4-9,12,17,20H,10-11,13H2,1-3H3 |
| InChIKey | HSXKRIWVAPBFEY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|