C18H19F3N2O4S — CID 90595606
N-[4-(3-methoxypyrrolidin-1-yl)phenyl]-4-(trifluoromethoxy)benzenesulfonamide (PubChem CID 90595606) has the molecular formula C18H19F3N2O4S and a molecular weight of 416.42 g/mol. Its IUPAC name is N-[4-(3-methoxypyrrolidin-1-yl)phenyl]-4-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-[4-(3-methoxypyrrolidin-1-yl)phenyl]-4-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 90595606 |
| Molecular Formula | C18H19F3N2O4S |
| Molecular Weight | 416.42 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | N-[4-(3-methoxypyrrolidin-1-yl)phenyl]-4-(trifluoromethoxy)benzenesulfonamide |
| SMILES | COC1CCN(c2ccc(NS(=O)(=O)c3ccc(OC(F)(F)F)cc3)cc2)C1 |
| InChI | InChI=1S/C18H19F3N2O4S/c1-26-16-10-11-23(12-16)14-4-2-13(3-5-14)22-28(24,25)17-8-6-15(7-9-17)27-18(19,20)21/h2-9,16,22H,10-12H2,1H3 |
| InChIKey | VKXRNZDLEZQGOB-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|