C21H28N2O3S — CID 121141771
N-[4-(3-methoxypiperidin-1-yl)phenyl]-2,4,6-trimethylbenzenesulfonamide (PubChem CID 121141771) has the molecular formula C21H28N2O3S and a molecular weight of 388.53 g/mol. Its IUPAC name is N-[4-(3-methoxypiperidin-1-yl)phenyl]-2,4,6-trimethylbenzenesulfonamide.
| Compound Name | N-[4-(3-methoxypiperidin-1-yl)phenyl]-2,4,6-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 121141771 |
| Molecular Formula | C21H28N2O3S |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | N-[4-(3-methoxypiperidin-1-yl)phenyl]-2,4,6-trimethylbenzenesulfonamide |
| SMILES | COC1CCCN(c2ccc(NS(=O)(=O)c3c(C)cc(C)cc3C)cc2)C1 |
| InChI | InChI=1S/C21H28N2O3S/c1-15-12-16(2)21(17(3)13-15)27(24,25)22-18-7-9-19(10-8-18)23-11-5-6-20(14-23)26-4/h7-10,12-13,20,22H,5-6,11,14H2,1-4H3 |
| InChIKey | QOHNSHLXDSVPDI-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|