C25H26FN3O4S — CID 121141504
4-[(3-fluorophenyl)sulfonylamino]-N-[4-(3-methoxypiperidin-1-yl)phenyl]benzamide (PubChem CID 121141504) has the molecular formula C25H26FN3O4S and a molecular weight of 483.57 g/mol. Its IUPAC name is 4-[(3-fluorophenyl)sulfonylamino]-N-[4-(3-methoxypiperidin-1-yl)phenyl]benzamide.
| Compound Name | 4-[(3-fluorophenyl)sulfonylamino]-N-[4-(3-methoxypiperidin-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 121141504 |
| Molecular Formula | C25H26FN3O4S |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | 4-[(3-fluorophenyl)sulfonylamino]-N-[4-(3-methoxypiperidin-1-yl)phenyl]benzamide |
| SMILES | COC1CCCN(c2ccc(NC(=O)c3ccc(NS(=O)(=O)c4cccc(F)c4)cc3)cc2)C1 |
| InChI | InChI=1S/C25H26FN3O4S/c1-33-23-5-3-15-29(17-23)22-13-11-20(12-14-22)27-25(30)18-7-9-21(10-8-18)28-34(31,32)24-6-2-4-19(26)16-24/h2,4,6-14,16,23,28H,3,5,15,17H2,1H3,(H,27,30) |
| InChIKey | ZSERCEXTPHZXIX-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|