C19H22F3N3O4S — CID 18180114
N-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]-4-(trifluoromethoxy)benzenesulfonamide (PubChem CID 18180114) has the molecular formula C19H22F3N3O4S and a molecular weight of 445.46 g/mol. Its IUPAC name is N-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]-4-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]-4-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 18180114 |
| Molecular Formula | C19H22F3N3O4S |
| Molecular Weight | 445.46 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | N-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]-4-(trifluoromethoxy)benzenesulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(OC(F)(F)F)cc2)cc1N1CCN(C)CC1 |
| InChI | InChI=1S/C19H22F3N3O4S/c1-24-9-11-25(12-10-24)17-13-14(3-8-18(17)28-2)23-30(26,27)16-6-4-15(5-7-16)29-19(20,21)22/h3-8,13,23H,9-12H2,1-2H3 |
| InChIKey | CPRSLDMOPNHGRU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.46 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |