C19H22F3N3O3S — CID 4796545
N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]-4-(trifluoromethoxy)benzenesulfonamide (PubChem CID 4796545) has the molecular formula C19H22F3N3O3S and a molecular weight of 429.46 g/mol. Its IUPAC name is N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]-4-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]-4-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 4796545 |
| Molecular Formula | C19H22F3N3O3S |
| Molecular Weight | 429.46 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]-4-(trifluoromethoxy)benzenesulfonamide |
| SMILES | Cc1cc(N2CCN(C)CC2)ccc1NS(=O)(=O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C19H22F3N3O3S/c1-14-13-15(25-11-9-24(2)10-12-25)3-8-18(14)23-29(26,27)17-6-4-16(5-7-17)28-19(20,21)22/h3-8,13,23H,9-12H2,1-2H3 |
| InChIKey | HSTREBQWEJPDPW-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.46 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|