C14H18F3N3O2 — CID 59454307
N-[5-(4-methylpiperazin-1-yl)-2-(trifluoromethoxy)phenyl]acetamide (PubChem CID 59454307) has the molecular formula C14H18F3N3O2 and a molecular weight of 317.31 g/mol. Its IUPAC name is N-[5-(4-methylpiperazin-1-yl)-2-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | N-[5-(4-methylpiperazin-1-yl)-2-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 59454307 |
| Molecular Formula | C14H18F3N3O2 |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | N-[5-(4-methylpiperazin-1-yl)-2-(trifluoromethoxy)phenyl]acetamide |
| SMILES | CC(=O)Nc1cc(N2CCN(C)CC2)ccc1OC(F)(F)F |
| InChI | InChI=1S/C14H18F3N3O2/c1-10(21)18-12-9-11(20-7-5-19(2)6-8-20)3-4-13(12)22-14(15,16)17/h3-4,9H,5-8H2,1-2H3,(H,18,21) |
| InChIKey | ZZJFFISOLMWGSE-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|