2-acetamido-5-(4-methyl-1,4-diazepan-1-yl)benzoic acid

C15H21N3O3 — CID 50782983

IUPAC2-acetamido-5-(4-methyl-1,4-diazepan-1-yl)benzoic acid
SMILESCC(=O)Nc1ccc(N2CCCN(C)CC2)cc1C(=O)O
InChIInChI=1S/C15H21N3O3/c1-11(19)16-14-5-4-12(10-13(14)15(20)21)18-7-3-6-17(2)8-9-18/h4-5,10H,3,6-9H2,1-2H3,(H,16,19)(H,20,21)
InChIKeyADRWALIUYCXNES-UHFFFAOYSA-N
MW291.35 g/mol
LogP1.49
Rot. Bonds3

About 2-acetamido-5-(4-methyl-1,4-diazepan-1-yl)benzoic acid

2-acetamido-5-(4-methyl-1,4-diazepan-1-yl)benzoic acid (PubChem CID 50782983) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is 2-acetamido-5-(4-methyl-1,4-diazepan-1-yl)benzoic acid.

Molecular Properties

Compound Name2-acetamido-5-(4-methyl-1,4-diazepan-1-yl)benzoic acid
PubChem CID50782983
Molecular FormulaC15H21N3O3
Molecular Weight291.35 g/mol
Exact Mass291.16
IUPAC Name2-acetamido-5-(4-methyl-1,4-diazepan-1-yl)benzoic acid
SMILESCC(=O)Nc1ccc(N2CCCN(C)CC2)cc1C(=O)O
InChIInChI=1S/C15H21N3O3/c1-11(19)16-14-5-4-12(10-13(14)15(20)21)18-7-3-6-17(2)8-9-18/h4-5,10H,3,6-9H2,1-2H3,(H,16,19)(H,20,21)
InChIKeyADRWALIUYCXNES-UHFFFAOYSA-N
XLogP1.49
TPSA72.88 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500291.35
LogP ≤ 51.49
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-acetamido-5-(4-methyl-1,4-diazepan-1-yl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-acetamido-5-(4-methyl-1,4-diazepan-1-yl)benzoic acid?
The IUPAC name of 2-acetamido-5-(4-methyl-1,4-diazepan-1-yl)benzoic acid (CID 50782983) is 2-acetamido-5-(4-methyl-1,4-diazepan-1-yl)benzoic acid.
What is the SMILES notation for 2-acetamido-5-(4-methyl-1,4-diazepan-1-yl)benzoic acid?
The canonical SMILES for 2-acetamido-5-(4-methyl-1,4-diazepan-1-yl)benzoic acid is CC(=O)Nc1ccc(N2CCCN(C)CC2)cc1C(=O)O.
What is the InChIKey of 2-acetamido-5-(4-methyl-1,4-diazepan-1-yl)benzoic acid?
The InChIKey is ADRWALIUYCXNES-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3O3/c1-11(19)16-14-5-4-12(10-13(14)15(20)21)18-7-3-6-17(2)8-9-18/h4-5,10H,3,6-9H2,1-2H3,(H,16,19)(H,20,21).
What are the key properties of 2-acetamido-5-(4-methyl-1,4-diazepan-1-yl)benzoic acid?
2-acetamido-5-(4-methyl-1,4-diazepan-1-yl)benzoic acid has a molecular weight of 291.35 g/mol, XLogP of 1.49, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetamido-5-(4-methyl-1,4-diazepan-1-yl)benzoic acid is sourced from PubChem (CID 50782983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).