C17H25N3O3 — CID 50782545
2-(3-methylbutanoylamino)-5-(4-methylpiperazin-1-yl)benzoic acid (PubChem CID 50782545) has the molecular formula C17H25N3O3 and a molecular weight of 319.41 g/mol. Its IUPAC name is 2-(3-methylbutanoylamino)-5-(4-methylpiperazin-1-yl)benzoic acid.
| Compound Name | 2-(3-methylbutanoylamino)-5-(4-methylpiperazin-1-yl)benzoic acid |
|---|---|
| PubChem CID | 50782545 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | 2-(3-methylbutanoylamino)-5-(4-methylpiperazin-1-yl)benzoic acid |
| SMILES | CC(C)CC(=O)Nc1ccc(N2CCN(C)CC2)cc1C(=O)O |
| InChI | InChI=1S/C17H25N3O3/c1-12(2)10-16(21)18-15-5-4-13(11-14(15)17(22)23)20-8-6-19(3)7-9-20/h4-5,11-12H,6-10H2,1-3H3,(H,18,21)(H,22,23) |
| InChIKey | MXUYLDOYMVAKDY-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |