C20H29N3O3 — CID 50782827
5-(4-piperidin-1-ylpiperidin-1-yl)-2-(propanoylamino)benzoic acid (PubChem CID 50782827) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is 5-(4-piperidin-1-ylpiperidin-1-yl)-2-(propanoylamino)benzoic acid.
| Compound Name | 5-(4-piperidin-1-ylpiperidin-1-yl)-2-(propanoylamino)benzoic acid |
|---|---|
| PubChem CID | 50782827 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | 5-(4-piperidin-1-ylpiperidin-1-yl)-2-(propanoylamino)benzoic acid |
| SMILES | CCC(=O)Nc1ccc(N2CCC(N3CCCCC3)CC2)cc1C(=O)O |
| InChI | InChI=1S/C20H29N3O3/c1-2-19(24)21-18-7-6-16(14-17(18)20(25)26)23-12-8-15(9-13-23)22-10-4-3-5-11-22/h6-7,14-15H,2-5,8-13H2,1H3,(H,21,24)(H,25,26) |
| InChIKey | VSTXQBVSZSJDPC-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |