C25H31N3O4 — CID 50782152
5-(4-cyclohexylpiperazin-1-yl)-2-[(4-methoxybenzoyl)amino]benzoic acid (PubChem CID 50782152) has the molecular formula C25H31N3O4 and a molecular weight of 437.54 g/mol. Its IUPAC name is 5-(4-cyclohexylpiperazin-1-yl)-2-[(4-methoxybenzoyl)amino]benzoic acid.
| Compound Name | 5-(4-cyclohexylpiperazin-1-yl)-2-[(4-methoxybenzoyl)amino]benzoic acid |
|---|---|
| PubChem CID | 50782152 |
| Molecular Formula | C25H31N3O4 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | 5-(4-cyclohexylpiperazin-1-yl)-2-[(4-methoxybenzoyl)amino]benzoic acid |
| SMILES | COc1ccc(C(=O)Nc2ccc(N3CCN(C4CCCCC4)CC3)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C25H31N3O4/c1-32-21-10-7-18(8-11-21)24(29)26-23-12-9-20(17-22(23)25(30)31)28-15-13-27(14-16-28)19-5-3-2-4-6-19/h7-12,17,19H,2-6,13-16H2,1H3,(H,26,29)(H,30,31) |
| InChIKey | CIEZNQRPIHSCEO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |