C23H29N3O4 — CID 50782170
2-(2,2-dimethylpropanoylamino)-5-[4-(4-methoxyphenyl)piperazin-1-yl]benzoic acid (PubChem CID 50782170) has the molecular formula C23H29N3O4 and a molecular weight of 411.50 g/mol. Its IUPAC name is 2-(2,2-dimethylpropanoylamino)-5-[4-(4-methoxyphenyl)piperazin-1-yl]benzoic acid.
| Compound Name | 2-(2,2-dimethylpropanoylamino)-5-[4-(4-methoxyphenyl)piperazin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 50782170 |
| Molecular Formula | C23H29N3O4 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 2-(2,2-dimethylpropanoylamino)-5-[4-(4-methoxyphenyl)piperazin-1-yl]benzoic acid |
| SMILES | COc1ccc(N2CCN(c3ccc(NC(=O)C(C)(C)C)c(C(=O)O)c3)CC2)cc1 |
| InChI | InChI=1S/C23H29N3O4/c1-23(2,3)22(29)24-20-10-7-17(15-19(20)21(27)28)26-13-11-25(12-14-26)16-5-8-18(30-4)9-6-16/h5-10,15H,11-14H2,1-4H3,(H,24,29)(H,27,28) |
| InChIKey | YHBKRGCABIEMAN-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|