C26H27N3O5 — CID 50782341
2-[(2-methoxybenzoyl)amino]-5-[4-(4-methoxyphenyl)piperazin-1-yl]benzoic acid (PubChem CID 50782341) has the molecular formula C26H27N3O5 and a molecular weight of 461.52 g/mol. Its IUPAC name is 2-[(2-methoxybenzoyl)amino]-5-[4-(4-methoxyphenyl)piperazin-1-yl]benzoic acid.
| Compound Name | 2-[(2-methoxybenzoyl)amino]-5-[4-(4-methoxyphenyl)piperazin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 50782341 |
| Molecular Formula | C26H27N3O5 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | 2-[(2-methoxybenzoyl)amino]-5-[4-(4-methoxyphenyl)piperazin-1-yl]benzoic acid |
| SMILES | COc1ccc(N2CCN(c3ccc(NC(=O)c4ccccc4OC)c(C(=O)O)c3)CC2)cc1 |
| InChI | InChI=1S/C26H27N3O5/c1-33-20-10-7-18(8-11-20)28-13-15-29(16-14-28)19-9-12-23(22(17-19)26(31)32)27-25(30)21-5-3-4-6-24(21)34-2/h3-12,17H,13-16H2,1-2H3,(H,27,30)(H,31,32) |
| InChIKey | CXHLOXLPHROTHD-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|