C26H26N2O5 — CID 146347180
2-[(2-methoxybenzoyl)amino]-5-(4-phenoxypiperidin-1-yl)benzoic acid (PubChem CID 146347180) has the molecular formula C26H26N2O5 and a molecular weight of 446.50 g/mol. Its IUPAC name is 2-[(2-methoxybenzoyl)amino]-5-(4-phenoxypiperidin-1-yl)benzoic acid.
| Compound Name | 2-[(2-methoxybenzoyl)amino]-5-(4-phenoxypiperidin-1-yl)benzoic acid |
|---|---|
| PubChem CID | 146347180 |
| Molecular Formula | C26H26N2O5 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 2-[(2-methoxybenzoyl)amino]-5-(4-phenoxypiperidin-1-yl)benzoic acid |
| SMILES | COc1ccccc1C(=O)Nc1ccc(N2CCC(Oc3ccccc3)CC2)cc1C(=O)O |
| InChI | InChI=1S/C26H26N2O5/c1-32-24-10-6-5-9-21(24)25(29)27-23-12-11-18(17-22(23)26(30)31)28-15-13-20(14-16-28)33-19-7-3-2-4-8-19/h2-12,17,20H,13-16H2,1H3,(H,27,29)(H,30,31) |
| InChIKey | TWXQTMAODADCRA-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |