C25H24ClN3O4 — CID 50782249
2-[(3-chlorobenzoyl)amino]-5-[4-(4-methoxyphenyl)piperazin-1-yl]benzoic acid (PubChem CID 50782249) has the molecular formula C25H24ClN3O4 and a molecular weight of 465.94 g/mol. Its IUPAC name is 2-[(3-chlorobenzoyl)amino]-5-[4-(4-methoxyphenyl)piperazin-1-yl]benzoic acid.
| Compound Name | 2-[(3-chlorobenzoyl)amino]-5-[4-(4-methoxyphenyl)piperazin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 50782249 |
| Molecular Formula | C25H24ClN3O4 |
| Molecular Weight | 465.94 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | 2-[(3-chlorobenzoyl)amino]-5-[4-(4-methoxyphenyl)piperazin-1-yl]benzoic acid |
| SMILES | COc1ccc(N2CCN(c3ccc(NC(=O)c4cccc(Cl)c4)c(C(=O)O)c3)CC2)cc1 |
| InChI | InChI=1S/C25H24ClN3O4/c1-33-21-8-5-19(6-9-21)28-11-13-29(14-12-28)20-7-10-23(22(16-20)25(31)32)27-24(30)17-3-2-4-18(26)15-17/h2-10,15-16H,11-14H2,1H3,(H,27,30)(H,31,32) |
| InChIKey | GFBRRHSOXYINNT-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.94 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|