C24H21F2N3O3 — CID 50782097
2-[(4-fluorobenzoyl)amino]-5-[4-(4-fluorophenyl)piperazin-1-yl]benzoic acid (PubChem CID 50782097) has the molecular formula C24H21F2N3O3 and a molecular weight of 437.45 g/mol. Its IUPAC name is 2-[(4-fluorobenzoyl)amino]-5-[4-(4-fluorophenyl)piperazin-1-yl]benzoic acid.
| Compound Name | 2-[(4-fluorobenzoyl)amino]-5-[4-(4-fluorophenyl)piperazin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 50782097 |
| Molecular Formula | C24H21F2N3O3 |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 2-[(4-fluorobenzoyl)amino]-5-[4-(4-fluorophenyl)piperazin-1-yl]benzoic acid |
| SMILES | O=C(Nc1ccc(N2CCN(c3ccc(F)cc3)CC2)cc1C(=O)O)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H21F2N3O3/c25-17-3-1-16(2-4-17)23(30)27-22-10-9-20(15-21(22)24(31)32)29-13-11-28(12-14-29)19-7-5-18(26)6-8-19/h1-10,15H,11-14H2,(H,27,30)(H,31,32) |
| InChIKey | VPVMKOKEUYWEMT-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |