C25H23F2N3O3 — CID 50782033
2-[(4-fluorobenzoyl)amino]-5-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]benzoic acid (PubChem CID 50782033) has the molecular formula C25H23F2N3O3 and a molecular weight of 451.47 g/mol. Its IUPAC name is 2-[(4-fluorobenzoyl)amino]-5-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]benzoic acid.
| Compound Name | 2-[(4-fluorobenzoyl)amino]-5-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 50782033 |
| Molecular Formula | C25H23F2N3O3 |
| Molecular Weight | 451.47 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 2-[(4-fluorobenzoyl)amino]-5-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]benzoic acid |
| SMILES | O=C(Nc1ccc(N2CCN(Cc3ccccc3F)CC2)cc1C(=O)O)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H23F2N3O3/c26-19-7-5-17(6-8-19)24(31)28-23-10-9-20(15-21(23)25(32)33)30-13-11-29(12-14-30)16-18-3-1-2-4-22(18)27/h1-10,15H,11-14,16H2,(H,28,31)(H,32,33) |
| InChIKey | IUUCEAHVLUVRHT-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.47 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |