C22H23FN2O5 — CID 95054136
5-[(3R)-3-ethoxycarbonylpiperidin-1-yl]-2-[(4-fluorobenzoyl)amino]benzoic acid (PubChem CID 95054136) has the molecular formula C22H23FN2O5 and a molecular weight of 414.43 g/mol. Its IUPAC name is 5-[(3R)-3-ethoxycarbonylpiperidin-1-yl]-2-[(4-fluorobenzoyl)amino]benzoic acid.
| Compound Name | 5-[(3R)-3-ethoxycarbonylpiperidin-1-yl]-2-[(4-fluorobenzoyl)amino]benzoic acid |
|---|---|
| PubChem CID | 95054136 |
| Molecular Formula | C22H23FN2O5 |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 5-[(3R)-3-ethoxycarbonylpiperidin-1-yl]-2-[(4-fluorobenzoyl)amino]benzoic acid |
| SMILES | CCOC(=O)[C@@H]1CCCN(c2ccc(NC(=O)c3ccc(F)cc3)c(C(=O)O)c2)C1 |
| InChI | InChI=1S/C22H23FN2O5/c1-2-30-22(29)15-4-3-11-25(13-15)17-9-10-19(18(12-17)21(27)28)24-20(26)14-5-7-16(23)8-6-14/h5-10,12,15H,2-4,11,13H2,1H3,(H,24,26)(H,27,28)/t15-/m1/s1 |
| InChIKey | SXGRJADWVFVJKX-OAHLLOKOSA-N |
| XLogP | 3.56 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |