C27H29N3O4 — CID 50782215
5-[4-(2,3-dimethylphenyl)piperazin-1-yl]-2-[(4-methoxybenzoyl)amino]benzoic acid (PubChem CID 50782215) has the molecular formula C27H29N3O4 and a molecular weight of 459.55 g/mol. Its IUPAC name is 5-[4-(2,3-dimethylphenyl)piperazin-1-yl]-2-[(4-methoxybenzoyl)amino]benzoic acid.
| Compound Name | 5-[4-(2,3-dimethylphenyl)piperazin-1-yl]-2-[(4-methoxybenzoyl)amino]benzoic acid |
|---|---|
| PubChem CID | 50782215 |
| Molecular Formula | C27H29N3O4 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | 5-[4-(2,3-dimethylphenyl)piperazin-1-yl]-2-[(4-methoxybenzoyl)amino]benzoic acid |
| SMILES | COc1ccc(C(=O)Nc2ccc(N3CCN(c4cccc(C)c4C)CC3)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C27H29N3O4/c1-18-5-4-6-25(19(18)2)30-15-13-29(14-16-30)21-9-12-24(23(17-21)27(32)33)28-26(31)20-7-10-22(34-3)11-8-20/h4-12,17H,13-16H2,1-3H3,(H,28,31)(H,32,33) |
| InChIKey | QREOEELQSFARMO-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |