C19H21N3O3 — CID 153403439
5-[4-(2,3-dimethylphenyl)piperazin-1-yl]-2-nitrosobenzoic acid (PubChem CID 153403439) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is 5-[4-(2,3-dimethylphenyl)piperazin-1-yl]-2-nitrosobenzoic acid.
| Compound Name | 5-[4-(2,3-dimethylphenyl)piperazin-1-yl]-2-nitrosobenzoic acid |
|---|---|
| PubChem CID | 153403439 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 5-[4-(2,3-dimethylphenyl)piperazin-1-yl]-2-nitrosobenzoic acid |
| SMILES | Cc1cccc(N2CCN(c3ccc(N=O)c(C(=O)O)c3)CC2)c1C |
| InChI | InChI=1S/C19H21N3O3/c1-13-4-3-5-18(14(13)2)22-10-8-21(9-11-22)15-6-7-17(20-25)16(12-15)19(23)24/h3-7,12H,8-11H2,1-2H3,(H,23,24) |
| InChIKey | LKQZHPSYGPZJPX-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 73.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |