C21H30N4O3 — CID 108944891
1-(4-acetylpiperazin-1-yl)-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]propane-1,3-dione (PubChem CID 108944891) has the molecular formula C21H30N4O3 and a molecular weight of 386.50 g/mol. Its IUPAC name is 1-(4-acetylpiperazin-1-yl)-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]propane-1,3-dione.
| Compound Name | 1-(4-acetylpiperazin-1-yl)-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]propane-1,3-dione |
|---|---|
| PubChem CID | 108944891 |
| Molecular Formula | C21H30N4O3 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | 1-(4-acetylpiperazin-1-yl)-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]propane-1,3-dione |
| SMILES | CC(=O)N1CCN(C(=O)CC(=O)N2CCN(c3cccc(C)c3C)CC2)CC1 |
| InChI | InChI=1S/C21H30N4O3/c1-16-5-4-6-19(17(16)2)23-9-13-25(14-10-23)21(28)15-20(27)24-11-7-22(8-12-24)18(3)26/h4-6H,7-15H2,1-3H3 |
| InChIKey | BTVRHQQCEVYWMZ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 64.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|