C16H22N2O2 — CID 18073226
1-[4-(2,3-dimethylphenyl)piperazin-1-yl]butane-1,3-dione (PubChem CID 18073226) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 1-[4-(2,3-dimethylphenyl)piperazin-1-yl]butane-1,3-dione.
| Compound Name | 1-[4-(2,3-dimethylphenyl)piperazin-1-yl]butane-1,3-dione |
|---|---|
| PubChem CID | 18073226 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 1-[4-(2,3-dimethylphenyl)piperazin-1-yl]butane-1,3-dione |
| SMILES | CC(=O)CC(=O)N1CCN(c2cccc(C)c2C)CC1 |
| InChI | InChI=1S/C16H22N2O2/c1-12-5-4-6-15(14(12)3)17-7-9-18(10-8-17)16(20)11-13(2)19/h4-6H,7-11H2,1-3H3 |
| InChIKey | UEWOOYRWLFEXHP-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|