C17H25BrN2O — CID 67721117
5-bromo-1-[4-(2,3-dimethylphenyl)piperazin-1-yl]pentan-1-one (PubChem CID 67721117) has the molecular formula C17H25BrN2O and a molecular weight of 353.30 g/mol. Its IUPAC name is 5-bromo-1-[4-(2,3-dimethylphenyl)piperazin-1-yl]pentan-1-one.
| Compound Name | 5-bromo-1-[4-(2,3-dimethylphenyl)piperazin-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 67721117 |
| Molecular Formula | C17H25BrN2O |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 5-bromo-1-[4-(2,3-dimethylphenyl)piperazin-1-yl]pentan-1-one |
| SMILES | Cc1cccc(N2CCN(C(=O)CCCCBr)CC2)c1C |
| InChI | InChI=1S/C17H25BrN2O/c1-14-6-5-7-16(15(14)2)19-10-12-20(13-11-19)17(21)8-3-4-9-18/h5-7H,3-4,8-13H2,1-2H3 |
| InChIKey | ILWVQERQHONLAV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|