C18H26N2O3 — CID 95054173
2-(3-methylbutanoylamino)-5-[(3S)-3-methylpiperidin-1-yl]benzoic acid (PubChem CID 95054173) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is 2-(3-methylbutanoylamino)-5-[(3S)-3-methylpiperidin-1-yl]benzoic acid.
| Compound Name | 2-(3-methylbutanoylamino)-5-[(3S)-3-methylpiperidin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 95054173 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 2-(3-methylbutanoylamino)-5-[(3S)-3-methylpiperidin-1-yl]benzoic acid |
| SMILES | CC(C)CC(=O)Nc1ccc(N2CCC[C@H](C)C2)cc1C(=O)O |
| InChI | InChI=1S/C18H26N2O3/c1-12(2)9-17(21)19-16-7-6-14(10-15(16)18(22)23)20-8-4-5-13(3)11-20/h6-7,10,12-13H,4-5,8-9,11H2,1-3H3,(H,19,21)(H,22,23)/t13-/m0/s1 |
| InChIKey | PVSKIZOBZXXWTC-ZDUSSCGKSA-N |
| XLogP | 3.61 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |