C13H16ClNO2 — CID 62945909
2-chloro-4-(3-methylpiperidin-1-yl)benzoic acid (PubChem CID 62945909) has the molecular formula C13H16ClNO2 and a molecular weight of 253.73 g/mol. Its IUPAC name is 2-chloro-4-(3-methylpiperidin-1-yl)benzoic acid.
| Compound Name | 2-chloro-4-(3-methylpiperidin-1-yl)benzoic acid |
|---|---|
| PubChem CID | 62945909 |
| Molecular Formula | C13H16ClNO2 |
| Molecular Weight | 253.73 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 2-chloro-4-(3-methylpiperidin-1-yl)benzoic acid |
| SMILES | CC1CCCN(c2ccc(C(=O)O)c(Cl)c2)C1 |
| InChI | InChI=1S/C13H16ClNO2/c1-9-3-2-6-15(8-9)10-4-5-11(13(16)17)12(14)7-10/h4-5,7,9H,2-3,6,8H2,1H3,(H,16,17) |
| InChIKey | VYAXOMARWYJELM-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.73 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |