C28H34N4O3 — CID 157128108
5-hydroxy-2-[[4-(4-methyl-1,4-diazepan-1-yl)benzoyl]amino]-N-(4-methylphenyl)benzamide;methane (PubChem CID 157128108) has the molecular formula C28H34N4O3 and a molecular weight of 474.61 g/mol. Its IUPAC name is 5-hydroxy-2-[[4-(4-methyl-1,4-diazepan-1-yl)benzoyl]amino]-N-(4-methylphenyl)benzamide;methane.
| Compound Name | 5-hydroxy-2-[[4-(4-methyl-1,4-diazepan-1-yl)benzoyl]amino]-N-(4-methylphenyl)benzamide;methane |
|---|---|
| PubChem CID | 157128108 |
| Molecular Formula | C28H34N4O3 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | 5-hydroxy-2-[[4-(4-methyl-1,4-diazepan-1-yl)benzoyl]amino]-N-(4-methylphenyl)benzamide;methane |
| SMILES | C.Cc1ccc(NC(=O)c2cc(O)ccc2NC(=O)c2ccc(N3CCCN(C)CC3)cc2)cc1 |
| InChI | InChI=1S/C27H30N4O3.CH4/c1-19-4-8-21(9-5-19)28-27(34)24-18-23(32)12-13-25(24)29-26(33)20-6-10-22(11-7-20)31-15-3-14-30(2)16-17-31;/h4-13,18,32H,3,14-17H2,1-2H3,(H,28,34)(H,29,33);1H4 |
| InChIKey | AISWECQLSIPKEF-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|