C26H27ClN4O2 — CID 118723665
N-(3-chlorophenyl)-2-[[4-(4-methyl-1,4-diazepan-1-yl)benzoyl]amino]benzamide (PubChem CID 118723665) has the molecular formula C26H27ClN4O2 and a molecular weight of 462.98 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-[[4-(4-methyl-1,4-diazepan-1-yl)benzoyl]amino]benzamide.
| Compound Name | N-(3-chlorophenyl)-2-[[4-(4-methyl-1,4-diazepan-1-yl)benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 118723665 |
| Molecular Formula | C26H27ClN4O2 |
| Molecular Weight | 462.98 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | N-(3-chlorophenyl)-2-[[4-(4-methyl-1,4-diazepan-1-yl)benzoyl]amino]benzamide |
| SMILES | CN1CCCN(c2ccc(C(=O)Nc3ccccc3C(=O)Nc3cccc(Cl)c3)cc2)CC1 |
| InChI | InChI=1S/C26H27ClN4O2/c1-30-14-5-15-31(17-16-30)22-12-10-19(11-13-22)25(32)29-24-9-3-2-8-23(24)26(33)28-21-7-4-6-20(27)18-21/h2-4,6-13,18H,5,14-17H2,1H3,(H,28,33)(H,29,32) |
| InChIKey | HFLHLOXUUALLOY-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.98 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |