C22H22F3N7O3 — CID 123342735
8-[5-(4-methylpiperazin-1-yl)-2-(trifluoromethoxy)anilino]-4,5-dihydro-2H-pyrazolo[4,3-h]quinazoline-3-carboxylic acid (PubChem CID 123342735) has the molecular formula C22H22F3N7O3 and a molecular weight of 489.46 g/mol. Its IUPAC name is 8-[5-(4-methylpiperazin-1-yl)-2-(trifluoromethoxy)anilino]-4,5-dihydro-2H-pyrazolo[4,3-h]quinazoline-3-carboxylic acid.
| Compound Name | 8-[5-(4-methylpiperazin-1-yl)-2-(trifluoromethoxy)anilino]-4,5-dihydro-2H-pyrazolo[4,3-h]quinazoline-3-carboxylic acid |
|---|---|
| PubChem CID | 123342735 |
| Molecular Formula | C22H22F3N7O3 |
| Molecular Weight | 489.46 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | 8-[5-(4-methylpiperazin-1-yl)-2-(trifluoromethoxy)anilino]-4,5-dihydro-2H-pyrazolo[4,3-h]quinazoline-3-carboxylic acid |
| SMILES | CN1CCN(c2ccc(OC(F)(F)F)c(Nc3ncc4c(n3)-c3n[nH]c(C(=O)O)c3CC4)c2)CC1 |
| InChI | InChI=1S/C22H22F3N7O3/c1-31-6-8-32(9-7-31)13-3-5-16(35-22(23,24)25)15(10-13)27-21-26-11-12-2-4-14-18(17(12)28-21)29-30-19(14)20(33)34/h3,5,10-11H,2,4,6-9H2,1H3,(H,29,30)(H,33,34)(H,26,27,28) |
| InChIKey | CDHVBVODVDFRAO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 119.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.46 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|