C26H26ClF3N6O2 — CID 175567500
6-[5-chloro-2-[5-(4-methylpiperazin-1-yl)-2-(trifluoromethoxy)anilino]pyrimidin-4-yl]-3,3-dimethyl-2H-isoindol-1-one (PubChem CID 175567500) has the molecular formula C26H26ClF3N6O2 and a molecular weight of 546.98 g/mol. Its IUPAC name is 6-[5-chloro-2-[5-(4-methylpiperazin-1-yl)-2-(trifluoromethoxy)anilino]pyrimidin-4-yl]-3,3-dimethyl-2H-isoindol-1-one.
| Compound Name | 6-[5-chloro-2-[5-(4-methylpiperazin-1-yl)-2-(trifluoromethoxy)anilino]pyrimidin-4-yl]-3,3-dimethyl-2H-isoindol-1-one |
|---|---|
| PubChem CID | 175567500 |
| Molecular Formula | C26H26ClF3N6O2 |
| Molecular Weight | 546.98 g/mol |
| Exact Mass | 546.18 |
| IUPAC Name | 6-[5-chloro-2-[5-(4-methylpiperazin-1-yl)-2-(trifluoromethoxy)anilino]pyrimidin-4-yl]-3,3-dimethyl-2H-isoindol-1-one |
| SMILES | CN1CCN(c2ccc(OC(F)(F)F)c(Nc3ncc(Cl)c(-c4ccc5c(c4)C(=O)NC5(C)C)n3)c2)CC1 |
| InChI | InChI=1S/C26H26ClF3N6O2/c1-25(2)18-6-4-15(12-17(18)23(37)34-25)22-19(27)14-31-24(33-22)32-20-13-16(36-10-8-35(3)9-11-36)5-7-21(20)38-26(28,29)30/h4-7,12-14H,8-11H2,1-3H3,(H,34,37)(H,31,32,33) |
| InChIKey | WFFZEHOBNJTISO-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.98 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|