C25H23F3N6O2S — CID 171457481
9-ethynyl-2-[5-(4-methylpiperazin-1-yl)-2-(trifluoromethoxy)anilino]-5,6-dihydrothieno[3,4-h]quinazoline-7-carboxamide (PubChem CID 171457481) has the molecular formula C25H23F3N6O2S and a molecular weight of 528.56 g/mol. Its IUPAC name is 9-ethynyl-2-[5-(4-methylpiperazin-1-yl)-2-(trifluoromethoxy)anilino]-5,6-dihydrothieno[3,4-h]quinazoline-7-carboxamide.
| Compound Name | 9-ethynyl-2-[5-(4-methylpiperazin-1-yl)-2-(trifluoromethoxy)anilino]-5,6-dihydrothieno[3,4-h]quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 171457481 |
| Molecular Formula | C25H23F3N6O2S |
| Molecular Weight | 528.56 g/mol |
| Exact Mass | 528.16 |
| IUPAC Name | 9-ethynyl-2-[5-(4-methylpiperazin-1-yl)-2-(trifluoromethoxy)anilino]-5,6-dihydrothieno[3,4-h]quinazoline-7-carboxamide |
| SMILES | C#Cc1sc(C(N)=O)c2c1-c1nc(Nc3cc(N4CCN(C)CC4)ccc3OC(F)(F)F)ncc1CC2 |
| InChI | InChI=1S/C25H23F3N6O2S/c1-3-19-20-16(22(37-19)23(29)35)6-4-14-13-30-24(32-21(14)20)31-17-12-15(34-10-8-33(2)9-11-34)5-7-18(17)36-25(26,27)28/h1,5,7,12-13H,4,6,8-11H2,2H3,(H2,29,35)(H,30,31,32) |
| InChIKey | OTUIVZRYHAPYMB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.56 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|