C13H7Cl3F3NO3S — CID 17154276
N-(2,4,5-trichlorophenyl)-4-(trifluoromethoxy)benzenesulfonamide (PubChem CID 17154276) has the molecular formula C13H7Cl3F3NO3S and a molecular weight of 420.62 g/mol. Its IUPAC name is N-(2,4,5-trichlorophenyl)-4-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-(2,4,5-trichlorophenyl)-4-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 17154276 |
| Molecular Formula | C13H7Cl3F3NO3S |
| Molecular Weight | 420.62 g/mol |
| Exact Mass | 418.92 |
| IUPAC Name | N-(2,4,5-trichlorophenyl)-4-(trifluoromethoxy)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cc(Cl)c(Cl)cc1Cl)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H7Cl3F3NO3S/c14-9-5-11(16)12(6-10(9)15)20-24(21,22)8-3-1-7(2-4-8)23-13(17,18)19/h1-6,20H |
| InChIKey | DMRNIOAPQKROPB-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.62 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|