C13H7Cl3N2O2S — CID 26979603
4-cyano-N-(2,4,5-trichlorophenyl)benzenesulfonamide (PubChem CID 26979603) has the molecular formula C13H7Cl3N2O2S and a molecular weight of 361.64 g/mol. Its IUPAC name is 4-cyano-N-(2,4,5-trichlorophenyl)benzenesulfonamide.
| Compound Name | 4-cyano-N-(2,4,5-trichlorophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 26979603 |
| Molecular Formula | C13H7Cl3N2O2S |
| Molecular Weight | 361.64 g/mol |
| Exact Mass | 359.93 |
| IUPAC Name | 4-cyano-N-(2,4,5-trichlorophenyl)benzenesulfonamide |
| SMILES | N#Cc1ccc(S(=O)(=O)Nc2cc(Cl)c(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C13H7Cl3N2O2S/c14-10-5-12(16)13(6-11(10)15)18-21(19,20)9-3-1-8(7-17)2-4-9/h1-6,18H |
| InChIKey | XYIICVNNQFKLKC-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.64 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|