C13H9Cl2N3O2S — CID 78965173
N-(2-amino-4-cyanophenyl)-3,4-dichlorobenzenesulfonamide (PubChem CID 78965173) has the molecular formula C13H9Cl2N3O2S and a molecular weight of 342.21 g/mol. Its IUPAC name is N-(2-amino-4-cyanophenyl)-3,4-dichlorobenzenesulfonamide.
| Compound Name | N-(2-amino-4-cyanophenyl)-3,4-dichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 78965173 |
| Molecular Formula | C13H9Cl2N3O2S |
| Molecular Weight | 342.21 g/mol |
| Exact Mass | 340.98 |
| IUPAC Name | N-(2-amino-4-cyanophenyl)-3,4-dichlorobenzenesulfonamide |
| SMILES | N#Cc1ccc(NS(=O)(=O)c2ccc(Cl)c(Cl)c2)c(N)c1 |
| InChI | InChI=1S/C13H9Cl2N3O2S/c14-10-3-2-9(6-11(10)15)21(19,20)18-13-4-1-8(7-16)5-12(13)17/h1-6,18H,17H2 |
| InChIKey | MGSMCHKGMKTJON-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.21 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|