C14H11ClF3NO4S — CID 8523422
N-(3-chloro-4-methoxyphenyl)-4-(trifluoromethoxy)benzenesulfonamide (PubChem CID 8523422) has the molecular formula C14H11ClF3NO4S and a molecular weight of 381.76 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-4-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-4-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 8523422 |
| Molecular Formula | C14H11ClF3NO4S |
| Molecular Weight | 381.76 g/mol |
| Exact Mass | 381.00 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-4-(trifluoromethoxy)benzenesulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(OC(F)(F)F)cc2)cc1Cl |
| InChI | InChI=1S/C14H11ClF3NO4S/c1-22-13-7-2-9(8-12(13)15)19-24(20,21)11-5-3-10(4-6-11)23-14(16,17)18/h2-8,19H,1H3 |
| InChIKey | SVEMTGKXGHHHBF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.76 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |