C15H12F5NO5S — CID 36514229
N-[3-(difluoromethoxy)-4-methoxyphenyl]-4-(trifluoromethoxy)benzenesulfonamide (PubChem CID 36514229) has the molecular formula C15H12F5NO5S and a molecular weight of 413.32 g/mol. Its IUPAC name is N-[3-(difluoromethoxy)-4-methoxyphenyl]-4-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-[3-(difluoromethoxy)-4-methoxyphenyl]-4-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 36514229 |
| Molecular Formula | C15H12F5NO5S |
| Molecular Weight | 413.32 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | N-[3-(difluoromethoxy)-4-methoxyphenyl]-4-(trifluoromethoxy)benzenesulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(OC(F)(F)F)cc2)cc1OC(F)F |
| InChI | InChI=1S/C15H12F5NO5S/c1-24-12-7-2-9(8-13(12)25-14(16)17)21-27(22,23)11-5-3-10(4-6-11)26-15(18,19)20/h2-8,14,21H,1H3 |
| InChIKey | JUHXVHIMXORVOX-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.32 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |