C18H14F5NO4 — CID 46530562
(E)-N-[3-(difluoromethoxy)-4-methoxyphenyl]-3-[4-(trifluoromethoxy)phenyl]prop-2-enamide (PubChem CID 46530562) has the molecular formula C18H14F5NO4 and a molecular weight of 403.30 g/mol. Its IUPAC name is (E)-N-[3-(difluoromethoxy)-4-methoxyphenyl]-3-[4-(trifluoromethoxy)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[3-(difluoromethoxy)-4-methoxyphenyl]-3-[4-(trifluoromethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 46530562 |
| Molecular Formula | C18H14F5NO4 |
| Molecular Weight | 403.30 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | (E)-N-[3-(difluoromethoxy)-4-methoxyphenyl]-3-[4-(trifluoromethoxy)phenyl]prop-2-enamide |
| SMILES | COc1ccc(NC(=O)/C=C/c2ccc(OC(F)(F)F)cc2)cc1OC(F)F |
| InChI | InChI=1S/C18H14F5NO4/c1-26-14-8-5-12(10-15(14)27-17(19)20)24-16(25)9-4-11-2-6-13(7-3-11)28-18(21,22)23/h2-10,17H,1H3,(H,24,25)/b9-4+ |
| InChIKey | LYBUUCOQHVHMOC-RUDMXATFSA-N |
| XLogP | 4.85 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.30 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|